C9H11N5S — CID 80652908
2-N-(4,5-dimethyl-1,3-thiazol-2-yl)pyrazine-2,5-diamine (PubChem CID 80652908) has the molecular formula C9H11N5S and a molecular weight of 221.29 g/mol. Its IUPAC name is 2-N-(4,5-dimethyl-1,3-thiazol-2-yl)pyrazine-2,5-diamine.
| Compound Name | 2-N-(4,5-dimethyl-1,3-thiazol-2-yl)pyrazine-2,5-diamine |
|---|---|
| PubChem CID | 80652908 |
| Molecular Formula | C9H11N5S |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-N-(4,5-dimethyl-1,3-thiazol-2-yl)pyrazine-2,5-diamine |
| SMILES | Cc1nc(Nc2cnc(N)cn2)sc1C |
| InChI | InChI=1S/C9H11N5S/c1-5-6(2)15-9(13-5)14-8-4-11-7(10)3-12-8/h3-4H,1-2H3,(H2,10,11)(H,12,13,14) |
| InChIKey | SOWVKAKTVODVIO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |