C12H19N5O — CID 80652914
5-(3-morpholin-4-ylpyrrolidin-1-yl)pyrazin-2-amine (PubChem CID 80652914) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 5-(3-morpholin-4-ylpyrrolidin-1-yl)pyrazin-2-amine.
| Compound Name | 5-(3-morpholin-4-ylpyrrolidin-1-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 80652914 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 5-(3-morpholin-4-ylpyrrolidin-1-yl)pyrazin-2-amine |
| SMILES | Nc1cnc(N2CCC(N3CCOCC3)C2)cn1 |
| InChI | InChI=1S/C12H19N5O/c13-11-7-15-12(8-14-11)17-2-1-10(9-17)16-3-5-18-6-4-16/h7-8,10H,1-6,9H2,(H2,13,14) |
| InChIKey | NVJZQLOMTASFHF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |