About 6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine
6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine (PubChem CID 80653054) has the molecular formula C11H17N3O
and a molecular weight of 207.28 g/mol. Its IUPAC name is 6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine |
| PubChem CID | 80653054 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine |
| SMILES | CC1CN(c2cccc(N)n2)CCCO1 |
| InChI | InChI=1S/C11H17N3O/c1-9-8-14(6-3-7-15-9)11-5-2-4-10(12)13-11/h2,4-5,9H,3,6-8H2,1H3,(H2,12,13) |
| InChIKey | DVIRVNWFSSZSPJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine?
The IUPAC name of 6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine (CID 80653054) is 6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine.
What is the SMILES notation for 6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine?
The canonical SMILES for 6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine is CC1CN(c2cccc(N)n2)CCCO1.
What is the InChIKey of 6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine?
The InChIKey is DVIRVNWFSSZSPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O/c1-9-8-14(6-3-7-15-9)11-5-2-4-10(12)13-11/h2,4-5,9H,3,6-8H2,1H3,(H2,12,13).
What are the key properties of 6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine?
6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine has a molecular weight of 207.28 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methyl-1,4-oxazepan-4-yl)pyridin-2-amine is sourced from PubChem (CID 80653054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).