About 6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine
6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine (PubChem CID 80653168) has the molecular formula C14H17N3
and a molecular weight of 227.31 g/mol. Its IUPAC name is 6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine.
Molecular Properties
| Compound Name | 6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine |
| PubChem CID | 80653168 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine |
| SMILES | Cc1cc(C)cc(N(C)c2cccc(N)n2)c1 |
| InChI | InChI=1S/C14H17N3/c1-10-7-11(2)9-12(8-10)17(3)14-6-4-5-13(15)16-14/h4-9H,1-3H3,(H2,15,16) |
| InChIKey | POKAZXORCMDLLT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine?
The IUPAC name of 6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine (CID 80653168) is 6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine.
What is the SMILES notation for 6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine?
The canonical SMILES for 6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine is Cc1cc(C)cc(N(C)c2cccc(N)n2)c1.
What is the InChIKey of 6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine?
The InChIKey is POKAZXORCMDLLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3/c1-10-7-11(2)9-12(8-10)17(3)14-6-4-5-13(15)16-14/h4-9H,1-3H3,(H2,15,16).
What are the key properties of 6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine?
6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine has a molecular weight of 227.31 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-(3,5-dimethylphenyl)-6-N-methylpyridine-2,6-diamine is sourced from PubChem (CID 80653168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).