C16H16N2O2S — CID 80655201
4-[6-(3-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]butanoic acid (PubChem CID 80655201) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 4-[6-(3-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]butanoic acid.
| Compound Name | 4-[6-(3-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 80655201 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-[6-(3-methylphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]butanoic acid |
| SMILES | Cc1cccc(-c2cn3c(CCCC(=O)O)csc3n2)c1 |
| InChI | InChI=1S/C16H16N2O2S/c1-11-4-2-5-12(8-11)14-9-18-13(6-3-7-15(19)20)10-21-16(18)17-14/h2,4-5,8-10H,3,6-7H2,1H3,(H,19,20) |
| InChIKey | BMSYIAWDTIRTEI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |