About 1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one
1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one (PubChem CID 80655902) has the molecular formula C11H18N6O
and a molecular weight of 250.31 g/mol. Its IUPAC name is 1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one |
| PubChem CID | 80655902 |
| Molecular Formula | C11H18N6O |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one |
| SMILES | Cc1cc(NN)nc(CN2CCNC(=O)CC2)n1 |
| InChI | InChI=1S/C11H18N6O/c1-8-6-9(16-12)15-10(14-8)7-17-4-2-11(18)13-3-5-17/h6H,2-5,7,12H2,1H3,(H,13,18)(H,14,15,16) |
| InChIKey | USBQFZNVWRPHLE-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one?
The IUPAC name of 1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one (CID 80655902) is 1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one.
What is the SMILES notation for 1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one?
The canonical SMILES for 1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one is Cc1cc(NN)nc(CN2CCNC(=O)CC2)n1.
What is the InChIKey of 1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one?
The InChIKey is USBQFZNVWRPHLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N6O/c1-8-6-9(16-12)15-10(14-8)7-17-4-2-11(18)13-3-5-17/h6H,2-5,7,12H2,1H3,(H,13,18)(H,14,15,16).
What are the key properties of 1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one?
1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one has a molecular weight of 250.31 g/mol, XLogP of -0.61, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-1,4-diazepan-5-one is sourced from PubChem (CID 80655902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).