About [6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine
[6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine (PubChem CID 80656225) has the molecular formula C15H20N4O
and a molecular weight of 272.35 g/mol. Its IUPAC name is [6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine |
| PubChem CID | 80656225 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | [6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1cc(C)c(OCc2nc(C)cc(NN)n2)c(C)c1 |
| InChI | InChI=1S/C15H20N4O/c1-9-5-10(2)15(11(3)6-9)20-8-14-17-12(4)7-13(18-14)19-16/h5-7H,8,16H2,1-4H3,(H,17,18,19) |
| InChIKey | WLHPWRMDVZJHCL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine?
The IUPAC name of [6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine (CID 80656225) is [6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine.
What is the SMILES notation for [6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine?
The canonical SMILES for [6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine is Cc1cc(C)c(OCc2nc(C)cc(NN)n2)c(C)c1.
What is the InChIKey of [6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine?
The InChIKey is WLHPWRMDVZJHCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O/c1-9-5-10(2)15(11(3)6-9)20-8-14-17-12(4)7-13(18-14)19-16/h5-7H,8,16H2,1-4H3,(H,17,18,19).
What are the key properties of [6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine?
[6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine has a molecular weight of 272.35 g/mol, XLogP of 2.57, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-methyl-2-[(2,4,6-trimethylphenoxy)methyl]pyrimidin-4-yl]hydrazine is sourced from PubChem (CID 80656225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).