About 2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine
2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine (PubChem CID 80656245) has the molecular formula C10H19N5S
and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine |
| PubChem CID | 80656245 |
| Molecular Formula | C10H19N5S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine |
| SMILES | Cc1cc(NN)nc(CSCCN(C)C)n1 |
| InChI | InChI=1S/C10H19N5S/c1-8-6-9(14-11)13-10(12-8)7-16-5-4-15(2)3/h6H,4-5,7,11H2,1-3H3,(H,12,13,14) |
| InChIKey | RTGODQSNSUDYOZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine?
The IUPAC name of 2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine (CID 80656245) is 2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine is Cc1cc(NN)nc(CSCCN(C)C)n1.
What is the InChIKey of 2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine?
The InChIKey is RTGODQSNSUDYOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5S/c1-8-6-9(14-11)13-10(12-8)7-16-5-4-15(2)3/h6H,4-5,7,11H2,1-3H3,(H,12,13,14).
What are the key properties of 2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine?
2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine has a molecular weight of 241.36 g/mol, XLogP of 0.87, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methylsulfanyl]-N,N-dimethylethanamine is sourced from PubChem (CID 80656245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).