About 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one
3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one (PubChem CID 80656727) has the molecular formula C10H13N5OS
and a molecular weight of 251.31 g/mol. Its IUPAC name is 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one |
| PubChem CID | 80656727 |
| Molecular Formula | C10H13N5OS |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one |
| SMILES | Cc1cc(NN)nc(Cn2c(C)csc2=O)n1 |
| InChI | InChI=1S/C10H13N5OS/c1-6-3-8(14-11)13-9(12-6)4-15-7(2)5-17-10(15)16/h3,5H,4,11H2,1-2H3,(H,12,13,14) |
| InChIKey | DFPNKMPBVQCQIL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one?
The IUPAC name of 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one (CID 80656727) is 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one.
What is the SMILES notation for 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one?
The canonical SMILES for 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one is Cc1cc(NN)nc(Cn2c(C)csc2=O)n1.
What is the InChIKey of 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one?
The InChIKey is DFPNKMPBVQCQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5OS/c1-6-3-8(14-11)13-9(12-6)4-15-7(2)5-17-10(15)16/h3,5H,4,11H2,1-2H3,(H,12,13,14).
What are the key properties of 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one?
3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one has a molecular weight of 251.31 g/mol, XLogP of 0.65, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-hydrazinyl-6-methylpyrimidin-2-yl)methyl]-4-methyl-1,3-thiazol-2-one is sourced from PubChem (CID 80656727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).