C14H22N4O2 — CID 80657136
ethyl 1-[(4-amino-6-methylpyrimidin-2-yl)methyl]piperidine-4-carboxylate (PubChem CID 80657136) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is ethyl 1-[(4-amino-6-methylpyrimidin-2-yl)methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(4-amino-6-methylpyrimidin-2-yl)methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 80657136 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | ethyl 1-[(4-amino-6-methylpyrimidin-2-yl)methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cc2nc(C)cc(N)n2)CC1 |
| InChI | InChI=1S/C14H22N4O2/c1-3-20-14(19)11-4-6-18(7-5-11)9-13-16-10(2)8-12(15)17-13/h8,11H,3-7,9H2,1-2H3,(H2,15,16,17) |
| InChIKey | XTEWLCYVTFHYLQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |