C12H18ClN3O2 — CID 80658262
methyl 2-[(4-chloro-6-methylpyrimidin-2-yl)methyl-propan-2-ylamino]acetate (PubChem CID 80658262) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is methyl 2-[(4-chloro-6-methylpyrimidin-2-yl)methyl-propan-2-ylamino]acetate.
| Compound Name | methyl 2-[(4-chloro-6-methylpyrimidin-2-yl)methyl-propan-2-ylamino]acetate |
|---|---|
| PubChem CID | 80658262 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | methyl 2-[(4-chloro-6-methylpyrimidin-2-yl)methyl-propan-2-ylamino]acetate |
| SMILES | COC(=O)CN(Cc1nc(C)cc(Cl)n1)C(C)C |
| InChI | InChI=1S/C12H18ClN3O2/c1-8(2)16(7-12(17)18-4)6-11-14-9(3)5-10(13)15-11/h5,8H,6-7H2,1-4H3 |
| InChIKey | KFOKKPNCTFEPRZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |