C12H12BrCl2NO — CID 80659980
(3-bromopiperidin-1-yl)-(2,3-dichlorophenyl)methanone (PubChem CID 80659980) has the molecular formula C12H12BrCl2NO and a molecular weight of 337.04 g/mol. Its IUPAC name is (3-bromopiperidin-1-yl)-(2,3-dichlorophenyl)methanone.
| Compound Name | (3-bromopiperidin-1-yl)-(2,3-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 80659980 |
| Molecular Formula | C12H12BrCl2NO |
| Molecular Weight | 337.04 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | (3-bromopiperidin-1-yl)-(2,3-dichlorophenyl)methanone |
| SMILES | O=C(c1cccc(Cl)c1Cl)N1CCCC(Br)C1 |
| InChI | InChI=1S/C12H12BrCl2NO/c13-8-3-2-6-16(7-8)12(17)9-4-1-5-10(14)11(9)15/h1,4-5,8H,2-3,6-7H2 |
| InChIKey | IJXAXCPWIAXIRW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.04 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|