C11H18BrN3O — CID 80661046
N-(2-bromoethyl)-N,3-diethyl-1-methylpyrazole-5-carboxamide (PubChem CID 80661046) has the molecular formula C11H18BrN3O and a molecular weight of 288.19 g/mol. Its IUPAC name is N-(2-bromoethyl)-N,3-diethyl-1-methylpyrazole-5-carboxamide.
| Compound Name | N-(2-bromoethyl)-N,3-diethyl-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 80661046 |
| Molecular Formula | C11H18BrN3O |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | N-(2-bromoethyl)-N,3-diethyl-1-methylpyrazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)N(CC)CCBr)n(C)n1 |
| InChI | InChI=1S/C11H18BrN3O/c1-4-9-8-10(14(3)13-9)11(16)15(5-2)7-6-12/h8H,4-7H2,1-3H3 |
| InChIKey | DSQOSFVXIWBTMR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|