About methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate
methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate (PubChem CID 80661808) has the molecular formula C10H12N2O2S
and a molecular weight of 224.28 g/mol. Its IUPAC name is methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate.
Molecular Properties
| Compound Name | methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate |
| PubChem CID | 80661808 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate |
| SMILES | COC(=O)CCCc1csc2nccn12 |
| InChI | InChI=1S/C10H12N2O2S/c1-14-9(13)4-2-3-8-7-15-10-11-5-6-12(8)10/h5-7H,2-4H2,1H3 |
| InChIKey | BKFUUCJGXXJLAK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate?
The IUPAC name of methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate (CID 80661808) is methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate.
What is the SMILES notation for methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate?
The canonical SMILES for methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate is COC(=O)CCCc1csc2nccn12.
What is the InChIKey of methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate?
The InChIKey is BKFUUCJGXXJLAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S/c1-14-9(13)4-2-3-8-7-15-10-11-5-6-12(8)10/h5-7H,2-4H2,1H3.
What are the key properties of methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate?
methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate has a molecular weight of 224.28 g/mol, XLogP of 1.89, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-imidazo[2,1-b][1,3]thiazol-3-ylbutanoate is sourced from PubChem (CID 80661808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).