C15H16BrN3O — CID 80661828
N-(2-bromocyclopentyl)-1-phenylpyrazole-4-carboxamide (PubChem CID 80661828) has the molecular formula C15H16BrN3O and a molecular weight of 334.22 g/mol. Its IUPAC name is N-(2-bromocyclopentyl)-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-(2-bromocyclopentyl)-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 80661828 |
| Molecular Formula | C15H16BrN3O |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-(2-bromocyclopentyl)-1-phenylpyrazole-4-carboxamide |
| SMILES | O=C(NC1CCCC1Br)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C15H16BrN3O/c16-13-7-4-8-14(13)18-15(20)11-9-17-19(10-11)12-5-2-1-3-6-12/h1-3,5-6,9-10,13-14H,4,7-8H2,(H,18,20) |
| InChIKey | ZESALJVAFZKZKZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|