C14H19N5O2 — CID 80663115
2-[(4-amino-6-methylpyrimidin-2-yl)methyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 80663115) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-[(4-amino-6-methylpyrimidin-2-yl)methyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-[(4-amino-6-methylpyrimidin-2-yl)methyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 80663115 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-[(4-amino-6-methylpyrimidin-2-yl)methyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | Cc1cc(N)nc(CN2CC(=O)N3CCCCC3C2=O)n1 |
| InChI | InChI=1S/C14H19N5O2/c1-9-6-11(15)17-12(16-9)7-18-8-13(20)19-5-3-2-4-10(19)14(18)21/h6,10H,2-5,7-8H2,1H3,(H2,15,16,17) |
| InChIKey | YEBSQXWEDAPTSF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |