C9H8ClF5N2O — CID 80663312
4-chloro-6-methyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)pyrimidine (PubChem CID 80663312) has the molecular formula C9H8ClF5N2O and a molecular weight of 290.62 g/mol. Its IUPAC name is 4-chloro-6-methyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)pyrimidine.
| Compound Name | 4-chloro-6-methyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 80663312 |
| Molecular Formula | C9H8ClF5N2O |
| Molecular Weight | 290.62 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 4-chloro-6-methyl-2-(2,2,3,3,3-pentafluoropropoxymethyl)pyrimidine |
| SMILES | Cc1cc(Cl)nc(COCC(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C9H8ClF5N2O/c1-5-2-6(10)17-7(16-5)3-18-4-8(11,12)9(13,14)15/h2H,3-4H2,1H3 |
| InChIKey | OSKMXMPNPXEQJH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|