About 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine
5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine (PubChem CID 80663619) has the molecular formula C8H9N5S2
and a molecular weight of 239.33 g/mol. Its IUPAC name is 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine |
| PubChem CID | 80663619 |
| Molecular Formula | C8H9N5S2 |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine |
| SMILES | CCc1nsc(Sc2cnc(N)cn2)n1 |
| InChI | InChI=1S/C8H9N5S2/c1-2-6-12-8(15-13-6)14-7-4-10-5(9)3-11-7/h3-4H,2H2,1H3,(H2,9,10) |
| InChIKey | PQCWGZLOHAHSCM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine?
The IUPAC name of 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine (CID 80663619) is 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine.
What is the SMILES notation for 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine?
The canonical SMILES for 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine is CCc1nsc(Sc2cnc(N)cn2)n1.
What is the InChIKey of 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine?
The InChIKey is PQCWGZLOHAHSCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5S2/c1-2-6-12-8(15-13-6)14-7-4-10-5(9)3-11-7/h3-4H,2H2,1H3,(H2,9,10).
What are the key properties of 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine?
5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine has a molecular weight of 239.33 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]pyrazin-2-amine is sourced from PubChem (CID 80663619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).