C14H20N6O — CID 80663942
2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 80663942) has the molecular formula C14H20N6O and a molecular weight of 288.36 g/mol. Its IUPAC name is 2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 80663942 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CCNc1cc(C)nc(Cn2nc3n(c2=O)CCCC3)n1 |
| InChI | InChI=1S/C14H20N6O/c1-3-15-11-8-10(2)16-12(17-11)9-20-14(21)19-7-5-4-6-13(19)18-20/h8H,3-7,9H2,1-2H3,(H,15,16,17) |
| InChIKey | JUHSFTUTUKCHGW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |