C17H23N3O — CID 80663952
2-[(2-butan-2-ylphenoxy)methyl]-N,6-dimethylpyrimidin-4-amine (PubChem CID 80663952) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[(2-butan-2-ylphenoxy)methyl]-N,6-dimethylpyrimidin-4-amine.
| Compound Name | 2-[(2-butan-2-ylphenoxy)methyl]-N,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80663952 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2-[(2-butan-2-ylphenoxy)methyl]-N,6-dimethylpyrimidin-4-amine |
| SMILES | CCC(C)c1ccccc1OCc1nc(C)cc(NC)n1 |
| InChI | InChI=1S/C17H23N3O/c1-5-12(2)14-8-6-7-9-15(14)21-11-17-19-13(3)10-16(18-4)20-17/h6-10,12H,5,11H2,1-4H3,(H,18,19,20) |
| InChIKey | SHHGNBOKSYXSJC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |