C10H14ClN3S — CID 80664038
2-(azetidin-3-ylmethylsulfanylmethyl)-4-chloro-6-methylpyrimidine (PubChem CID 80664038) has the molecular formula C10H14ClN3S and a molecular weight of 243.76 g/mol. Its IUPAC name is 2-(azetidin-3-ylmethylsulfanylmethyl)-4-chloro-6-methylpyrimidine.
| Compound Name | 2-(azetidin-3-ylmethylsulfanylmethyl)-4-chloro-6-methylpyrimidine |
|---|---|
| PubChem CID | 80664038 |
| Molecular Formula | C10H14ClN3S |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-(azetidin-3-ylmethylsulfanylmethyl)-4-chloro-6-methylpyrimidine |
| SMILES | Cc1cc(Cl)nc(CSCC2CNC2)n1 |
| InChI | InChI=1S/C10H14ClN3S/c1-7-2-9(11)14-10(13-7)6-15-5-8-3-12-4-8/h2,8,12H,3-6H2,1H3 |
| InChIKey | MNPGJZFYDGLNIQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |