About 4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine
4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine (PubChem CID 80664132) has the molecular formula C8H8ClN5
and a molecular weight of 209.64 g/mol. Its IUPAC name is 4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine |
| PubChem CID | 80664132 |
| Molecular Formula | C8H8ClN5 |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine |
| SMILES | Cc1cc(Cl)nc(Cn2cncn2)n1 |
| InChI | InChI=1S/C8H8ClN5/c1-6-2-7(9)13-8(12-6)3-14-5-10-4-11-14/h2,4-5H,3H2,1H3 |
| InChIKey | CHRMKLICAKNVNJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine?
The IUPAC name of 4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine (CID 80664132) is 4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine.
What is the SMILES notation for 4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine?
The canonical SMILES for 4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine is Cc1cc(Cl)nc(Cn2cncn2)n1.
What is the InChIKey of 4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine?
The InChIKey is CHRMKLICAKNVNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN5/c1-6-2-7(9)13-8(12-6)3-14-5-10-4-11-14/h2,4-5H,3H2,1H3.
What are the key properties of 4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine?
4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine has a molecular weight of 209.64 g/mol, XLogP of 1.08, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-methyl-2-(1,2,4-triazol-1-ylmethyl)pyrimidine is sourced from PubChem (CID 80664132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).