About 5-phenoxypyrazin-2-amine
5-phenoxypyrazin-2-amine (PubChem CID 80664406) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 5-phenoxypyrazin-2-amine.
Molecular Properties
| Compound Name | 5-phenoxypyrazin-2-amine |
| PubChem CID | 80664406 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 5-phenoxypyrazin-2-amine |
| SMILES | Nc1cnc(Oc2ccccc2)cn1 |
| InChI | InChI=1S/C10H9N3O/c11-9-6-13-10(7-12-9)14-8-4-2-1-3-5-8/h1-7H,(H2,11,12) |
| InChIKey | OIPCJVFEMJRTNB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-phenoxypyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenoxypyrazin-2-amine?
The IUPAC name of 5-phenoxypyrazin-2-amine (CID 80664406) is 5-phenoxypyrazin-2-amine.
What is the SMILES notation for 5-phenoxypyrazin-2-amine?
The canonical SMILES for 5-phenoxypyrazin-2-amine is Nc1cnc(Oc2ccccc2)cn1.
What is the InChIKey of 5-phenoxypyrazin-2-amine?
The InChIKey is OIPCJVFEMJRTNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c11-9-6-13-10(7-12-9)14-8-4-2-1-3-5-8/h1-7H,(H2,11,12).
What are the key properties of 5-phenoxypyrazin-2-amine?
5-phenoxypyrazin-2-amine has a molecular weight of 187.20 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenoxypyrazin-2-amine is sourced from PubChem (CID 80664406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).