About 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine
4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine (PubChem CID 80664820) has the molecular formula C13H20ClN3
and a molecular weight of 253.78 g/mol. Its IUPAC name is 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine |
| PubChem CID | 80664820 |
| Molecular Formula | C13H20ClN3 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine |
| SMILES | Cc1cc(Cl)nc(CN2CC(C)CC(C)C2)n1 |
| InChI | InChI=1S/C13H20ClN3/c1-9-4-10(2)7-17(6-9)8-13-15-11(3)5-12(14)16-13/h5,9-10H,4,6-8H2,1-3H3 |
| InChIKey | LBSRLIUWUWZNEO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine?
The IUPAC name of 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine (CID 80664820) is 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine.
What is the SMILES notation for 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine?
The canonical SMILES for 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine is Cc1cc(Cl)nc(CN2CC(C)CC(C)C2)n1.
What is the InChIKey of 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine?
The InChIKey is LBSRLIUWUWZNEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20ClN3/c1-9-4-10(2)7-17(6-9)8-13-15-11(3)5-12(14)16-13/h5,9-10H,4,6-8H2,1-3H3.
What are the key properties of 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine?
4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine has a molecular weight of 253.78 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-methylpyrimidine is sourced from PubChem (CID 80664820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).