C12H14BrCl2NO — CID 80665677
N-(2-bromoethyl)-2,3-dichloro-N-propan-2-ylbenzamide (PubChem CID 80665677) has the molecular formula C12H14BrCl2NO and a molecular weight of 339.06 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,3-dichloro-N-propan-2-ylbenzamide.
| Compound Name | N-(2-bromoethyl)-2,3-dichloro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 80665677 |
| Molecular Formula | C12H14BrCl2NO |
| Molecular Weight | 339.06 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | N-(2-bromoethyl)-2,3-dichloro-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(CCBr)C(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H14BrCl2NO/c1-8(2)16(7-6-13)12(17)9-4-3-5-10(14)11(9)15/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | FJQXZOGEPPSWNS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.06 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|