C14H20BrNO — CID 80666132
N-(2-bromopropyl)-2-(2,5-dimethylphenyl)-N-methylacetamide (PubChem CID 80666132) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is N-(2-bromopropyl)-2-(2,5-dimethylphenyl)-N-methylacetamide.
| Compound Name | N-(2-bromopropyl)-2-(2,5-dimethylphenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 80666132 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-(2-bromopropyl)-2-(2,5-dimethylphenyl)-N-methylacetamide |
| SMILES | Cc1ccc(C)c(CC(=O)N(C)CC(C)Br)c1 |
| InChI | InChI=1S/C14H20BrNO/c1-10-5-6-11(2)13(7-10)8-14(17)16(4)9-12(3)15/h5-7,12H,8-9H2,1-4H3 |
| InChIKey | MOQUXCFUHDYPQO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|