About 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane
1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane (PubChem CID 80666638) has the molecular formula C16H23BrN2S
and a molecular weight of 355.35 g/mol. Its IUPAC name is 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane |
| PubChem CID | 80666638 |
| Molecular Formula | C16H23BrN2S |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane |
| SMILES | BrCCN1CCCN(CC2CSc3ccccc32)CC1 |
| InChI | InChI=1S/C16H23BrN2S/c17-6-9-18-7-3-8-19(11-10-18)12-14-13-20-16-5-2-1-4-15(14)16/h1-2,4-5,14H,3,6-13H2 |
| InChIKey | IIXXWXXSZZLWAX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane?
The IUPAC name of 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane (CID 80666638) is 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane.
What is the SMILES notation for 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane?
The canonical SMILES for 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane is BrCCN1CCCN(CC2CSc3ccccc32)CC1.
What is the InChIKey of 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane?
The InChIKey is IIXXWXXSZZLWAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23BrN2S/c17-6-9-18-7-3-8-19(11-10-18)12-14-13-20-16-5-2-1-4-15(14)16/h1-2,4-5,14H,3,6-13H2.
What are the key properties of 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane?
1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane has a molecular weight of 355.35 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromoethyl)-4-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1,4-diazepane is sourced from PubChem (CID 80666638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).