C11H14BrN5 — CID 80667013
N-(2-bromoethyl)-N-cyclopropyl-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 80667013) has the molecular formula C11H14BrN5 and a molecular weight of 296.17 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-cyclopropyl-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | N-(2-bromoethyl)-N-cyclopropyl-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80667013 |
| Molecular Formula | C11H14BrN5 |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | N-(2-bromoethyl)-N-cyclopropyl-3-methyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | Cc1nnc2c(N(CCBr)C3CC3)nccn12 |
| InChI | InChI=1S/C11H14BrN5/c1-8-14-15-11-10(13-5-7-16(8)11)17(6-4-12)9-2-3-9/h5,7,9H,2-4,6H2,1H3 |
| InChIKey | ADCWURPVLGNCBF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|