C7H12BrF2N — CID 80668531
2-(bromomethyl)-1-(2,2-difluoroethyl)pyrrolidine (PubChem CID 80668531) has the molecular formula C7H12BrF2N and a molecular weight of 228.08 g/mol. Its IUPAC name is 2-(bromomethyl)-1-(2,2-difluoroethyl)pyrrolidine.
| Compound Name | 2-(bromomethyl)-1-(2,2-difluoroethyl)pyrrolidine |
|---|---|
| PubChem CID | 80668531 |
| Molecular Formula | C7H12BrF2N |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 2-(bromomethyl)-1-(2,2-difluoroethyl)pyrrolidine |
| SMILES | FC(F)CN1CCCC1CBr |
| InChI | InChI=1S/C7H12BrF2N/c8-4-6-2-1-3-11(6)5-7(9)10/h6-7H,1-5H2 |
| InChIKey | WBESBQKMMKVTGP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|