C12H19BrN4O2 — CID 80669323
N-(2-bromoethyl)-N-cyclopentyl-4,6-dimethoxy-1,3,5-triazin-2-amine (PubChem CID 80669323) has the molecular formula C12H19BrN4O2 and a molecular weight of 331.21 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-cyclopentyl-4,6-dimethoxy-1,3,5-triazin-2-amine.
| Compound Name | N-(2-bromoethyl)-N-cyclopentyl-4,6-dimethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80669323 |
| Molecular Formula | C12H19BrN4O2 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-(2-bromoethyl)-N-cyclopentyl-4,6-dimethoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(OC)nc(N(CCBr)C2CCCC2)n1 |
| InChI | InChI=1S/C12H19BrN4O2/c1-18-11-14-10(15-12(16-11)19-2)17(8-7-13)9-5-3-4-6-9/h9H,3-8H2,1-2H3 |
| InChIKey | CYCRXRWTSNAZTM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|