C14H18BrN3S — CID 80670146
4-[4-(bromomethyl)piperidin-1-yl]-5,6-dimethylthieno[2,3-d]pyrimidine (PubChem CID 80670146) has the molecular formula C14H18BrN3S and a molecular weight of 340.29 g/mol. Its IUPAC name is 4-[4-(bromomethyl)piperidin-1-yl]-5,6-dimethylthieno[2,3-d]pyrimidine.
| Compound Name | 4-[4-(bromomethyl)piperidin-1-yl]-5,6-dimethylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 80670146 |
| Molecular Formula | C14H18BrN3S |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 4-[4-(bromomethyl)piperidin-1-yl]-5,6-dimethylthieno[2,3-d]pyrimidine |
| SMILES | Cc1sc2ncnc(N3CCC(CBr)CC3)c2c1C |
| InChI | InChI=1S/C14H18BrN3S/c1-9-10(2)19-14-12(9)13(16-8-17-14)18-5-3-11(7-15)4-6-18/h8,11H,3-7H2,1-2H3 |
| InChIKey | CPWQORSWKYQLAP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|