About N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide
N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide (PubChem CID 80670651) has the molecular formula C5H10BrF2NO2S
and a molecular weight of 266.11 g/mol. Its IUPAC name is N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide |
| PubChem CID | 80670651 |
| Molecular Formula | C5H10BrF2NO2S |
| Molecular Weight | 266.11 g/mol |
| Exact Mass | 264.96 |
| IUPAC Name | N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide |
| SMILES | CC(Br)CN(C)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C5H10BrF2NO2S/c1-4(6)3-9(2)12(10,11)5(7)8/h4-5H,3H2,1-2H3 |
| InChIKey | QNADMRIAPNIWMG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.11 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide?
The IUPAC name of N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide (CID 80670651) is N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide.
What is the SMILES notation for N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide?
The canonical SMILES for N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide is CC(Br)CN(C)S(=O)(=O)C(F)F.
What is the InChIKey of N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide?
The InChIKey is QNADMRIAPNIWMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10BrF2NO2S/c1-4(6)3-9(2)12(10,11)5(7)8/h4-5H,3H2,1-2H3.
What are the key properties of N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide?
N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide has a molecular weight of 266.11 g/mol, XLogP of 1.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromopropyl)-1,1-difluoro-N-methylmethanesulfonamide is sourced from PubChem (CID 80670651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).