C12H16Br3NO2S — CID 80672347
2,5-dibromo-N-(3-bromopropyl)-N-propan-2-ylbenzenesulfonamide (PubChem CID 80672347) has the molecular formula C12H16Br3NO2S and a molecular weight of 478.04 g/mol. Its IUPAC name is 2,5-dibromo-N-(3-bromopropyl)-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(3-bromopropyl)-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 80672347 |
| Molecular Formula | C12H16Br3NO2S |
| Molecular Weight | 478.04 g/mol |
| Exact Mass | 474.85 |
| IUPAC Name | 2,5-dibromo-N-(3-bromopropyl)-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)N(CCCBr)S(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H16Br3NO2S/c1-9(2)16(7-3-6-13)19(17,18)12-8-10(14)4-5-11(12)15/h4-5,8-9H,3,6-7H2,1-2H3 |
| InChIKey | FGARVHUCEYMCHR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.04 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|