About N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine
N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 80673016) has the molecular formula C10H12BrN3S
and a molecular weight of 286.20 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 80673016 |
| Molecular Formula | C10H12BrN3S |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCN(CCBr)c1ncnc2sccc12 |
| InChI | InChI=1S/C10H12BrN3S/c1-2-14(5-4-11)9-8-3-6-15-10(8)13-7-12-9/h3,6-7H,2,4-5H2,1H3 |
| InChIKey | RWJKPGGAEQINBF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine (CID 80673016) is N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine is CCN(CCBr)c1ncnc2sccc12.
What is the InChIKey of N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine?
The InChIKey is RWJKPGGAEQINBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN3S/c1-2-14(5-4-11)9-8-3-6-15-10(8)13-7-12-9/h3,6-7H,2,4-5H2,1H3.
What are the key properties of N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine?
N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine has a molecular weight of 286.20 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromoethyl)-N-ethylthieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 80673016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).