C16H19BrN2 — CID 80673665
6-[[2-(bromomethyl)piperidin-1-yl]methyl]quinoline (PubChem CID 80673665) has the molecular formula C16H19BrN2 and a molecular weight of 319.25 g/mol. Its IUPAC name is 6-[[2-(bromomethyl)piperidin-1-yl]methyl]quinoline.
| Compound Name | 6-[[2-(bromomethyl)piperidin-1-yl]methyl]quinoline |
|---|---|
| PubChem CID | 80673665 |
| Molecular Formula | C16H19BrN2 |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 6-[[2-(bromomethyl)piperidin-1-yl]methyl]quinoline |
| SMILES | BrCC1CCCCN1Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C16H19BrN2/c17-11-15-5-1-2-9-19(15)12-13-6-7-16-14(10-13)4-3-8-18-16/h3-4,6-8,10,15H,1-2,5,9,11-12H2 |
| InChIKey | BTUSGLCMQCPZSO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|