C11H17BrN2S — CID 80673929
2-[3-(bromomethyl)piperidin-1-yl]-4-ethyl-1,3-thiazole (PubChem CID 80673929) has the molecular formula C11H17BrN2S and a molecular weight of 289.24 g/mol. Its IUPAC name is 2-[3-(bromomethyl)piperidin-1-yl]-4-ethyl-1,3-thiazole.
| Compound Name | 2-[3-(bromomethyl)piperidin-1-yl]-4-ethyl-1,3-thiazole |
|---|---|
| PubChem CID | 80673929 |
| Molecular Formula | C11H17BrN2S |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-[3-(bromomethyl)piperidin-1-yl]-4-ethyl-1,3-thiazole |
| SMILES | CCc1csc(N2CCCC(CBr)C2)n1 |
| InChI | InChI=1S/C11H17BrN2S/c1-2-10-8-15-11(13-10)14-5-3-4-9(6-12)7-14/h8-9H,2-7H2,1H3 |
| InChIKey | XSGVNGQUGLGKRH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|