C12H14BrN3S — CID 80676014
4-[2-(bromomethyl)piperidin-1-yl]thieno[2,3-d]pyrimidine (PubChem CID 80676014) has the molecular formula C12H14BrN3S and a molecular weight of 312.24 g/mol. Its IUPAC name is 4-[2-(bromomethyl)piperidin-1-yl]thieno[2,3-d]pyrimidine.
| Compound Name | 4-[2-(bromomethyl)piperidin-1-yl]thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 80676014 |
| Molecular Formula | C12H14BrN3S |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 4-[2-(bromomethyl)piperidin-1-yl]thieno[2,3-d]pyrimidine |
| SMILES | BrCC1CCCCN1c1ncnc2sccc12 |
| InChI | InChI=1S/C12H14BrN3S/c13-7-9-3-1-2-5-16(9)11-10-4-6-17-12(10)15-8-14-11/h4,6,8-9H,1-3,5,7H2 |
| InChIKey | KNKNJOCHDPLLNG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|