C15H18BrNO — CID 80677432
7-bicyclo[4.2.0]octa-1,3,5-trienyl-[4-(bromomethyl)piperidin-1-yl]methanone (PubChem CID 80677432) has the molecular formula C15H18BrNO and a molecular weight of 308.22 g/mol. Its IUPAC name is 7-bicyclo[4.2.0]octa-1,3,5-trienyl-[4-(bromomethyl)piperidin-1-yl]methanone.
| Compound Name | 7-bicyclo[4.2.0]octa-1,3,5-trienyl-[4-(bromomethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 80677432 |
| Molecular Formula | C15H18BrNO |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 7-bicyclo[4.2.0]octa-1,3,5-trienyl-[4-(bromomethyl)piperidin-1-yl]methanone |
| SMILES | O=C(C1Cc2ccccc21)N1CCC(CBr)CC1 |
| InChI | InChI=1S/C15H18BrNO/c16-10-11-5-7-17(8-6-11)15(18)14-9-12-3-1-2-4-13(12)14/h1-4,11,14H,5-10H2 |
| InChIKey | CIUUKRKEZWFRFH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|