About 3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine
3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine (PubChem CID 80679410) has the molecular formula C16H22BrNO
and a molecular weight of 324.26 g/mol. Its IUPAC name is 3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine.
Molecular Properties
| Compound Name | 3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine |
| PubChem CID | 80679410 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine |
| SMILES | BrCC1CCCN(CC2OCCc3ccccc32)C1 |
| InChI | InChI=1S/C16H22BrNO/c17-10-13-4-3-8-18(11-13)12-16-15-6-2-1-5-14(15)7-9-19-16/h1-2,5-6,13,16H,3-4,7-12H2 |
| InChIKey | IYRJDFGKPXQOIL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine?
The IUPAC name of 3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine (CID 80679410) is 3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine.
What is the SMILES notation for 3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine?
The canonical SMILES for 3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine is BrCC1CCCN(CC2OCCc3ccccc32)C1.
What is the InChIKey of 3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine?
The InChIKey is IYRJDFGKPXQOIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BrNO/c17-10-13-4-3-8-18(11-13)12-16-15-6-2-1-5-14(15)7-9-19-16/h1-2,5-6,13,16H,3-4,7-12H2.
What are the key properties of 3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine?
3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine has a molecular weight of 324.26 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)-1-(3,4-dihydro-1H-isochromen-1-ylmethyl)piperidine is sourced from PubChem (CID 80679410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).