C13H20BrN5 — CID 80679479
N-(2-bromoethyl)-3-methyl-N-pentan-3-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 80679479) has the molecular formula C13H20BrN5 and a molecular weight of 326.24 g/mol. Its IUPAC name is N-(2-bromoethyl)-3-methyl-N-pentan-3-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | N-(2-bromoethyl)-3-methyl-N-pentan-3-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80679479 |
| Molecular Formula | C13H20BrN5 |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-(2-bromoethyl)-3-methyl-N-pentan-3-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | CCC(CC)N(CCBr)c1nccn2c(C)nnc12 |
| InChI | InChI=1S/C13H20BrN5/c1-4-11(5-2)19(8-6-14)12-13-17-16-10(3)18(13)9-7-15-12/h7,9,11H,4-6,8H2,1-3H3 |
| InChIKey | HOUPQNXEWYSHGV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|