C13H19BrN2 — CID 80679655
2-[2-(3-bromopropyl)pyrrolidin-1-yl]-4-methylpyridine (PubChem CID 80679655) has the molecular formula C13H19BrN2 and a molecular weight of 283.21 g/mol. Its IUPAC name is 2-[2-(3-bromopropyl)pyrrolidin-1-yl]-4-methylpyridine.
| Compound Name | 2-[2-(3-bromopropyl)pyrrolidin-1-yl]-4-methylpyridine |
|---|---|
| PubChem CID | 80679655 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-[2-(3-bromopropyl)pyrrolidin-1-yl]-4-methylpyridine |
| SMILES | Cc1ccnc(N2CCCC2CCCBr)c1 |
| InChI | InChI=1S/C13H19BrN2/c1-11-6-8-15-13(10-11)16-9-3-5-12(16)4-2-7-14/h6,8,10,12H,2-5,7,9H2,1H3 |
| InChIKey | JJVAQMCQWMPJMM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|