C11H16BrN3 — CID 80680091
3-[3-(bromomethyl)pyrrolidin-1-yl]-2,5-dimethylpyrazine (PubChem CID 80680091) has the molecular formula C11H16BrN3 and a molecular weight of 270.17 g/mol. Its IUPAC name is 3-[3-(bromomethyl)pyrrolidin-1-yl]-2,5-dimethylpyrazine.
| Compound Name | 3-[3-(bromomethyl)pyrrolidin-1-yl]-2,5-dimethylpyrazine |
|---|---|
| PubChem CID | 80680091 |
| Molecular Formula | C11H16BrN3 |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 3-[3-(bromomethyl)pyrrolidin-1-yl]-2,5-dimethylpyrazine |
| SMILES | Cc1cnc(C)c(N2CCC(CBr)C2)n1 |
| InChI | InChI=1S/C11H16BrN3/c1-8-6-13-9(2)11(14-8)15-4-3-10(5-12)7-15/h6,10H,3-5,7H2,1-2H3 |
| InChIKey | ZRCAFCMBGKHSLG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|