About 3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine
3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine (PubChem CID 80680558) has the molecular formula C15H22BrN
and a molecular weight of 296.25 g/mol. Its IUPAC name is 3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine.
Molecular Properties
| Compound Name | 3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine |
| PubChem CID | 80680558 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine |
| SMILES | Cc1cc(C)c(CN2CCCC(Br)C2)c(C)c1 |
| InChI | InChI=1S/C15H22BrN/c1-11-7-12(2)15(13(3)8-11)10-17-6-4-5-14(16)9-17/h7-8,14H,4-6,9-10H2,1-3H3 |
| InChIKey | UCCRVTPCIYXXCJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine?
The IUPAC name of 3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine (CID 80680558) is 3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine.
What is the SMILES notation for 3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine?
The canonical SMILES for 3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine is Cc1cc(C)c(CN2CCCC(Br)C2)c(C)c1.
What is the InChIKey of 3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine?
The InChIKey is UCCRVTPCIYXXCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22BrN/c1-11-7-12(2)15(13(3)8-11)10-17-6-4-5-14(16)9-17/h7-8,14H,4-6,9-10H2,1-3H3.
What are the key properties of 3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine?
3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine has a molecular weight of 296.25 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-[(2,4,6-trimethylphenyl)methyl]piperidine is sourced from PubChem (CID 80680558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).