C10H17BrN4 — CID 80680575
3-(bromomethyl)-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidine (PubChem CID 80680575) has the molecular formula C10H17BrN4 and a molecular weight of 273.18 g/mol. Its IUPAC name is 3-(bromomethyl)-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidine.
| Compound Name | 3-(bromomethyl)-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidine |
|---|---|
| PubChem CID | 80680575 |
| Molecular Formula | C10H17BrN4 |
| Molecular Weight | 273.18 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3-(bromomethyl)-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]piperidine |
| SMILES | Cn1ncnc1CN1CCCC(CBr)C1 |
| InChI | InChI=1S/C10H17BrN4/c1-14-10(12-8-13-14)7-15-4-2-3-9(5-11)6-15/h8-9H,2-7H2,1H3 |
| InChIKey | YDCJVOVDRWYQLN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|