C13H17IN4 — CID 80681094
1-(4-iodophenyl)-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]ethanamine (PubChem CID 80681094) has the molecular formula C13H17IN4 and a molecular weight of 356.21 g/mol. Its IUPAC name is 1-(4-iodophenyl)-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]ethanamine.
| Compound Name | 1-(4-iodophenyl)-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 80681094 |
| Molecular Formula | C13H17IN4 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 1-(4-iodophenyl)-N-[2-(1-methyl-1,2,4-triazol-3-yl)ethyl]ethanamine |
| SMILES | CC(NCCc1ncn(C)n1)c1ccc(I)cc1 |
| InChI | InChI=1S/C13H17IN4/c1-10(11-3-5-12(14)6-4-11)15-8-7-13-16-9-18(2)17-13/h3-6,9-10,15H,7-8H2,1-2H3 |
| InChIKey | BDVXWQGVVVVIBC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|