About 2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine
2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine (PubChem CID 80681465) has the molecular formula C13H15N5O
and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine.
Molecular Properties
| Compound Name | 2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine |
| PubChem CID | 80681465 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine |
| SMILES | Cn1cc(CCNc2nc3cc(N)ccc3o2)cn1 |
| InChI | InChI=1S/C13H15N5O/c1-18-8-9(7-16-18)4-5-15-13-17-11-6-10(14)2-3-12(11)19-13/h2-3,6-8H,4-5,14H2,1H3,(H,15,17) |
| InChIKey | OHPLCZRBEOMASM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine?
The IUPAC name of 2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine (CID 80681465) is 2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine.
What is the SMILES notation for 2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine?
The canonical SMILES for 2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine is Cn1cc(CCNc2nc3cc(N)ccc3o2)cn1.
What is the InChIKey of 2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine?
The InChIKey is OHPLCZRBEOMASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5O/c1-18-8-9(7-16-18)4-5-15-13-17-11-6-10(14)2-3-12(11)19-13/h2-3,6-8H,4-5,14H2,1H3,(H,15,17).
What are the key properties of 2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine?
2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine has a molecular weight of 257.30 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[2-(1-methylpyrazol-4-yl)ethyl]-1,3-benzoxazole-2,5-diamine is sourced from PubChem (CID 80681465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).