C8H13F3N4O — CID 80681844
1,1,1-trifluoro-3-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]propan-2-ol (PubChem CID 80681844) has the molecular formula C8H13F3N4O and a molecular weight of 238.21 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 80681844 |
| Molecular Formula | C8H13F3N4O |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 1,1,1-trifluoro-3-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]propan-2-ol |
| SMILES | Cn1cnc(CCNCC(O)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H13F3N4O/c1-15-5-13-7(14-15)2-3-12-4-6(16)8(9,10)11/h5-6,12,16H,2-4H2,1H3 |
| InChIKey | LQSCRYPDQPZTNY-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|