About 2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine
2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine (PubChem CID 80682491) has the molecular formula C8H13F3N4O
and a molecular weight of 238.21 g/mol. Its IUPAC name is 2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine.
Molecular Properties
| Compound Name | 2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine |
| PubChem CID | 80682491 |
| Molecular Formula | C8H13F3N4O |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine |
| SMILES | Cn1cnc(CCNCCOC(F)(F)F)n1 |
| InChI | InChI=1S/C8H13F3N4O/c1-15-6-13-7(14-15)2-3-12-4-5-16-8(9,10)11/h6,12H,2-5H2,1H3 |
| InChIKey | HMECWRZQERAZSV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine?
The IUPAC name of 2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine (CID 80682491) is 2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine.
What is the SMILES notation for 2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine?
The canonical SMILES for 2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine is Cn1cnc(CCNCCOC(F)(F)F)n1.
What is the InChIKey of 2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine?
The InChIKey is HMECWRZQERAZSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N4O/c1-15-6-13-7(14-15)2-3-12-4-5-16-8(9,10)11/h6,12H,2-5H2,1H3.
What are the key properties of 2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine?
2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine has a molecular weight of 238.21 g/mol, XLogP of 0.48, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-1,2,4-triazol-3-yl)-N-[2-(trifluoromethoxy)ethyl]ethanamine is sourced from PubChem (CID 80682491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).