C8H15N5O — CID 80683125
N'-hydroxy-2-[2-(1-methylpyrazol-4-yl)ethylamino]ethanimidamide (PubChem CID 80683125) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is N'-hydroxy-2-[2-(1-methylpyrazol-4-yl)ethylamino]ethanimidamide.
| Compound Name | N'-hydroxy-2-[2-(1-methylpyrazol-4-yl)ethylamino]ethanimidamide |
|---|---|
| PubChem CID | 80683125 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | N'-hydroxy-2-[2-(1-methylpyrazol-4-yl)ethylamino]ethanimidamide |
| SMILES | Cn1cc(CCNC/C(N)=N/O)cn1 |
| InChI | InChI=1S/C8H15N5O/c1-13-6-7(4-11-13)2-3-10-5-8(9)12-14/h4,6,10,14H,2-3,5H2,1H3,(H2,9,12) |
| InChIKey | UDGOCPFNOPJIFK-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|