C9H17N5O — CID 80683221
N,N-dimethyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]acetamide (PubChem CID 80683221) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]acetamide.
| Compound Name | N,N-dimethyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 80683221 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | N,N-dimethyl-2-[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]acetamide |
| SMILES | CN(C)C(=O)CNCCc1ncn(C)n1 |
| InChI | InChI=1S/C9H17N5O/c1-13(2)9(15)6-10-5-4-8-11-7-14(3)12-8/h7,10H,4-6H2,1-3H3 |
| InChIKey | HNCHWQBRNVAURO-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|